C37H51N5O4 — CID 155937508
(3S,6S,21E)-6-(6,6-dihydroxyoctyl)-5,8,18,27,34-pentazahexacyclo[25.2.2.17,10.111,15.114,18.01,3]tetratriaconta-7,9,11(33),12,14,16,21-heptaene-4,32-dione (PubChem CID 155937508) has the molecular formula C37H51N5O4 and a molecular weight of 629.85 g/mol. Its IUPAC name is (3S,6S,21E)-6-(6,6-dihydroxyoctyl)-5,8,18,27,34-pentazahexacyclo[25.2.2.17,10.111,15.114,18.01,3]tetratriaconta-7,9,11(33),12,14,16,21-heptaene-4,32-dione.
| Compound Name | (3S,6S,21E)-6-(6,6-dihydroxyoctyl)-5,8,18,27,34-pentazahexacyclo[25.2.2.17,10.111,15.114,18.01,3]tetratriaconta-7,9,11(33),12,14,16,21-heptaene-4,32-dione |
|---|---|
| PubChem CID | 155937508 |
| Molecular Formula | C37H51N5O4 |
| Molecular Weight | 629.85 g/mol |
| Exact Mass | 629.39 |
| IUPAC Name | (3S,6S,21E)-6-(6,6-dihydroxyoctyl)-5,8,18,27,34-pentazahexacyclo[25.2.2.17,10.111,15.114,18.01,3]tetratriaconta-7,9,11(33),12,14,16,21-heptaene-4,32-dione |
| SMILES | CCC(O)(O)CCCCC[C@@H]1NC(=O)[C@H]2CC23CCN(CCCC/C=C/CCn2ccc4cc(ccc4c2=O)-c2cnc1[nH]2)CC3 |
| InChI | InChI=1S/C37H51N5O4/c1-2-37(45,46)16-9-7-8-12-31-33-38-26-32(39-33)28-13-14-29-27(24-28)15-21-42(35(29)44)20-11-6-4-3-5-10-19-41-22-17-36(18-23-41)25-30(36)34(43)40-31/h4,6,13-15,21,24,26,30-31,45-46H,2-3,5,7-12,16-20,22-23,25H2,1H3,(H,38,39)(H,40,43)/b6-4+/t30-,31+/m1/s1 |
| InChIKey | ZYSTUIPWIBTSRG-PZILYNKDSA-N |
| XLogP | 5.82 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.85 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|