C19H23N7O3 — CID 155937887
formic acid;2-[1-(2-phenylethyl)-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,4-triazol-3-yl]acetamide (PubChem CID 155937887) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is formic acid;2-[1-(2-phenylethyl)-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,4-triazol-3-yl]acetamide.
| Compound Name | formic acid;2-[1-(2-phenylethyl)-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 155937887 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | formic acid;2-[1-(2-phenylethyl)-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-1,2,4-triazol-3-yl]acetamide |
| SMILES | NC(=O)Cc1nc(C2CCc3ncnn3C2)n(CCc2ccccc2)n1.O=CO |
| InChI | InChI=1S/C18H21N7O.CH2O2/c19-15(26)10-16-22-18(14-6-7-17-20-12-21-25(17)11-14)24(23-16)9-8-13-4-2-1-3-5-13;2-1-3/h1-5,12,14H,6-11H2,(H2,19,26);1H,(H,2,3) |
| InChIKey | YMMBOXFXMIRGKL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 141.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|