C19H27N5O4 — CID 155938181
acetic acid;2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclopentyl]-1-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]acetamide (PubChem CID 155938181) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is acetic acid;2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclopentyl]-1-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]acetamide.
| Compound Name | acetic acid;2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclopentyl]-1-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 155938181 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | acetic acid;2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclopentyl]-1-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]acetamide |
| SMILES | CC(=O)O.Cc1ccc(-n2nc(CC(N)=O)nc2[C@H]2C[C@@H](N)[C@H](O)C2)c(C)c1 |
| InChI | InChI=1S/C17H23N5O2.C2H4O2/c1-9-3-4-13(10(2)5-9)22-17(11-6-12(18)14(23)7-11)20-16(21-22)8-15(19)24;1-2(3)4/h3-5,11-12,14,23H,6-8,18H2,1-2H3,(H2,19,24);1H3,(H,3,4)/t11-,12+,14+;/m0./s1 |
| InChIKey | LDFYHDNRZSVAHC-UHQOWUJDSA-N |
| XLogP | 0.57 |
| TPSA | 157.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |