C15H17Cl2N5O2 — CID 166615007
2-[5-[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-1-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetamide (PubChem CID 166615007) has the molecular formula C15H17Cl2N5O2 and a molecular weight of 370.24 g/mol. Its IUPAC name is 2-[5-[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-1-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetamide.
| Compound Name | 2-[5-[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-1-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 166615007 |
| Molecular Formula | C15H17Cl2N5O2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-[5-[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-1-(3,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetamide |
| SMILES | NC(=O)Cc1nc([C@H]2C[C@H](N)[C@@H](O)C2)n(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C15H17Cl2N5O2/c16-9-2-1-8(5-10(9)17)22-15(7-3-11(18)12(23)4-7)20-14(21-22)6-13(19)24/h1-2,5,7,11-12,23H,3-4,6,18H2,(H2,19,24)/t7-,11-,12-/m0/s1 |
| InChIKey | OCXFHKGMSIGORQ-QILRFPOHSA-N |
| XLogP | 1.17 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |