C17H20Cl2N4O3 — CID 155500106
methyl 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 155500106) has the molecular formula C17H20Cl2N4O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is methyl 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | methyl 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 155500106 |
| Molecular Formula | C17H20Cl2N4O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | methyl 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(2,4-dichlorophenyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | COC(=O)Cc1nc([C@H]2CC[C@@H](O)[C@H](N)C2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H20Cl2N4O3/c1-26-16(25)8-15-21-17(9-2-5-14(24)12(20)6-9)23(22-15)13-4-3-10(18)7-11(13)19/h3-4,7,9,12,14,24H,2,5-6,8,20H2,1H3/t9-,12+,14+/m0/s1 |
| InChIKey | UCGOTVHMDDYZEV-MRCXROJRSA-N |
| XLogP | 2.25 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |