C22H29ClN6O2S — CID 155940924
2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(4-methyl-7-methylsulfanylquinolin-2-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;hydrochloride (PubChem CID 155940924) has the molecular formula C22H29ClN6O2S and a molecular weight of 477.03 g/mol. Its IUPAC name is 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(4-methyl-7-methylsulfanylquinolin-2-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;hydrochloride.
| Compound Name | 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(4-methyl-7-methylsulfanylquinolin-2-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 155940924 |
| Molecular Formula | C22H29ClN6O2S |
| Molecular Weight | 477.03 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[5-[(1S,3R,4R)-3-amino-4-hydroxycyclohexyl]-1-(4-methyl-7-methylsulfanylquinolin-2-yl)-1,2,4-triazol-3-yl]-N-methylacetamide;hydrochloride |
| SMILES | CNC(=O)Cc1nc([C@H]2CC[C@@H](O)[C@H](N)C2)n(-c2cc(C)c3ccc(SC)cc3n2)n1.Cl |
| InChI | InChI=1S/C22H28N6O2S.ClH/c1-12-8-20(25-17-10-14(31-3)5-6-15(12)17)28-22(13-4-7-18(29)16(23)9-13)26-19(27-28)11-21(30)24-2;/h5-6,8,10,13,16,18,29H,4,7,9,11,23H2,1-3H3,(H,24,30);1H/t13-,16+,18+;/m0./s1 |
| InChIKey | MBIFVIIEFZBTBK-UWQWILQWSA-N |
| XLogP | 2.51 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |