C18H25N9O2 — CID 155492948
2-[5-[(1S,3R,4R)-4-amino-3-methoxycyclohexyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,2,4-triazol-3-yl]-N-methylacetamide (PubChem CID 155492948) has the molecular formula C18H25N9O2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 2-[5-[(1S,3R,4R)-4-amino-3-methoxycyclohexyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,2,4-triazol-3-yl]-N-methylacetamide.
| Compound Name | 2-[5-[(1S,3R,4R)-4-amino-3-methoxycyclohexyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,2,4-triazol-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 155492948 |
| Molecular Formula | C18H25N9O2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-[5-[(1S,3R,4R)-4-amino-3-methoxycyclohexyl]-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1,2,4-triazol-3-yl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1nc([C@H]2CC[C@@H](N)[C@H](OC)C2)n(-c2ccc3nnc(C)n3n2)n1 |
| InChI | InChI=1S/C18H25N9O2/c1-10-22-23-15-6-7-16(25-26(10)15)27-18(21-14(24-27)9-17(28)20-2)11-4-5-12(19)13(8-11)29-3/h6-7,11-13H,4-5,8-9,19H2,1-3H3,(H,20,28)/t11-,12+,13+/m0/s1 |
| InChIKey | YFWIBSSXNRWBRF-YNEHKIRRSA-N |
| XLogP | -0.09 |
| TPSA | 138.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |