C18H27ClN4O — CID 155940653
(1R,2R,4S)-4-[2-(2,4-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-methoxycyclohexan-1-amine;hydrochloride (PubChem CID 155940653) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is (1R,2R,4S)-4-[2-(2,4-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-methoxycyclohexan-1-amine;hydrochloride.
| Compound Name | (1R,2R,4S)-4-[2-(2,4-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-methoxycyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155940653 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (1R,2R,4S)-4-[2-(2,4-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]-2-methoxycyclohexan-1-amine;hydrochloride |
| SMILES | CO[C@@H]1C[C@@H](c2nc(C)nn2-c2ccc(C)cc2C)CC[C@H]1N.Cl |
| InChI | InChI=1S/C18H26N4O.ClH/c1-11-5-8-16(12(2)9-11)22-18(20-13(3)21-22)14-6-7-15(19)17(10-14)23-4;/h5,8-9,14-15,17H,6-7,10,19H2,1-4H3;1H/t14-,15+,17+;/m0./s1 |
| InChIKey | KOIDYOPWZCYJAL-FFMLRVAQSA-N |
| XLogP | 3.22 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |