C16H18F3N3 — CID 155942479
2-methyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]azetidin-3-yl]methyl]imidazole (PubChem CID 155942479) has the molecular formula C16H18F3N3 and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-methyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]azetidin-3-yl]methyl]imidazole.
| Compound Name | 2-methyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]azetidin-3-yl]methyl]imidazole |
|---|---|
| PubChem CID | 155942479 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-methyl-1-[[1-[[3-(trifluoromethyl)phenyl]methyl]azetidin-3-yl]methyl]imidazole |
| SMILES | Cc1nccn1CC1CN(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H18F3N3/c1-12-20-5-6-22(12)11-14-9-21(10-14)8-13-3-2-4-15(7-13)16(17,18)19/h2-7,14H,8-11H2,1H3 |
| InChIKey | XDHGVNNEPZIRKO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |