C19H24F3N3 — CID 74244860
4-[2-(2-methylimidazol-1-yl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 74244860) has the molecular formula C19H24F3N3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 4-[2-(2-methylimidazol-1-yl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-[2-(2-methylimidazol-1-yl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 74244860 |
| Molecular Formula | C19H24F3N3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[2-(2-methylimidazol-1-yl)ethyl]-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | Cc1nccn1CCC1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F3N3/c1-15-23-8-12-25(15)11-7-16-5-9-24(10-6-16)14-17-3-2-4-18(13-17)19(20,21)22/h2-4,8,12-13,16H,5-7,9-11,14H2,1H3 |
| InChIKey | JBQIJOSLLVYUGE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |