C9H14N2O2 — CID 155943302
3,3-dimethyl-2-(1H-pyrazol-5-yl)butanoic acid (PubChem CID 155943302) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1H-pyrazol-5-yl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(1H-pyrazol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 155943302 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3,3-dimethyl-2-(1H-pyrazol-5-yl)butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H14N2O2/c1-9(2,3)7(8(12)13)6-4-5-10-11-6/h4-5,7H,1-3H3,(H,10,11)(H,12,13) |
| InChIKey | WHFCBVSRJSFOPQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |