C20H18BrFN4O2S — CID 155945639
2-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-N-(3-fluoro-4-imidazol-1-ylphenyl)propanamide (PubChem CID 155945639) has the molecular formula C20H18BrFN4O2S and a molecular weight of 477.36 g/mol. Its IUPAC name is 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-N-(3-fluoro-4-imidazol-1-ylphenyl)propanamide.
| Compound Name | 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-N-(3-fluoro-4-imidazol-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 155945639 |
| Molecular Formula | C20H18BrFN4O2S |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanyl-N-(3-fluoro-4-imidazol-1-ylphenyl)propanamide |
| SMILES | CC(SCC(=O)Nc1ccc(Br)cc1)C(=O)Nc1ccc(-n2ccnc2)c(F)c1 |
| InChI | InChI=1S/C20H18BrFN4O2S/c1-13(29-11-19(27)24-15-4-2-14(21)3-5-15)20(28)25-16-6-7-18(17(22)10-16)26-9-8-23-12-26/h2-10,12-13H,11H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | LUBNDGIRUURIEL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |