C12H15N3O4S — CID 155946386
2-(methanesulfonamido)ethyl 5-methyl-1H-indazole-7-carboxylate (PubChem CID 155946386) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-(methanesulfonamido)ethyl 5-methyl-1H-indazole-7-carboxylate.
| Compound Name | 2-(methanesulfonamido)ethyl 5-methyl-1H-indazole-7-carboxylate |
|---|---|
| PubChem CID | 155946386 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(methanesulfonamido)ethyl 5-methyl-1H-indazole-7-carboxylate |
| SMILES | Cc1cc(C(=O)OCCNS(C)(=O)=O)c2[nH]ncc2c1 |
| InChI | InChI=1S/C12H15N3O4S/c1-8-5-9-7-13-15-11(9)10(6-8)12(16)19-4-3-14-20(2,17)18/h5-7,14H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | XYEWTDMRIKIITN-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|