C17H18Cl2N4O2 — CID 155946645
(3-chloro-6-ethoxy-2-pyridinyl)-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone (PubChem CID 155946645) has the molecular formula C17H18Cl2N4O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is (3-chloro-6-ethoxy-2-pyridinyl)-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone.
| Compound Name | (3-chloro-6-ethoxy-2-pyridinyl)-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155946645 |
| Molecular Formula | C17H18Cl2N4O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (3-chloro-6-ethoxy-2-pyridinyl)-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]methanone |
| SMILES | CCOc1ccc(Cl)c(C(=O)N2CCN(c3ccc(Cl)cn3)CC2)n1 |
| InChI | InChI=1S/C17H18Cl2N4O2/c1-2-25-15-6-4-13(19)16(21-15)17(24)23-9-7-22(8-10-23)14-5-3-12(18)11-20-14/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | BDGCEUAANWYXRF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |