C19H16N2O6S — CID 155948755
2-[4-[(naphthalene-1-carbonylamino)sulfamoyl]phenoxy]acetic acid (PubChem CID 155948755) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is 2-[4-[(naphthalene-1-carbonylamino)sulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(naphthalene-1-carbonylamino)sulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 155948755 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-[4-[(naphthalene-1-carbonylamino)sulfamoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)NNC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C19H16N2O6S/c22-18(23)12-27-14-8-10-15(11-9-14)28(25,26)21-20-19(24)17-7-3-5-13-4-1-2-6-16(13)17/h1-11,21H,12H2,(H,20,24)(H,22,23) |
| InChIKey | FFQXEFHAXBDFFR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|