C18H15N5O2 — CID 155949161
N-[(3-pyridin-2-ylphenyl)methyl]-N'-pyrimidin-5-yloxamide (PubChem CID 155949161) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is N-[(3-pyridin-2-ylphenyl)methyl]-N'-pyrimidin-5-yloxamide.
| Compound Name | N-[(3-pyridin-2-ylphenyl)methyl]-N'-pyrimidin-5-yloxamide |
|---|---|
| PubChem CID | 155949161 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[(3-pyridin-2-ylphenyl)methyl]-N'-pyrimidin-5-yloxamide |
| SMILES | O=C(NCc1cccc(-c2ccccn2)c1)C(=O)Nc1cncnc1 |
| InChI | InChI=1S/C18H15N5O2/c24-17(18(25)23-15-10-19-12-20-11-15)22-9-13-4-3-5-14(8-13)16-6-1-2-7-21-16/h1-8,10-12H,9H2,(H,22,24)(H,23,25) |
| InChIKey | FYJHXESCDSPWRG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|