C25H27N5O2 — CID 166231717
N'-[2-(4-methylpiperazin-1-yl)phenyl]-N-[(3-pyridin-2-ylphenyl)methyl]oxamide (PubChem CID 166231717) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N'-[2-(4-methylpiperazin-1-yl)phenyl]-N-[(3-pyridin-2-ylphenyl)methyl]oxamide.
| Compound Name | N'-[2-(4-methylpiperazin-1-yl)phenyl]-N-[(3-pyridin-2-ylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 166231717 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N'-[2-(4-methylpiperazin-1-yl)phenyl]-N-[(3-pyridin-2-ylphenyl)methyl]oxamide |
| SMILES | CN1CCN(c2ccccc2NC(=O)C(=O)NCc2cccc(-c3ccccn3)c2)CC1 |
| InChI | InChI=1S/C25H27N5O2/c1-29-13-15-30(16-14-29)23-11-3-2-10-22(23)28-25(32)24(31)27-18-19-7-6-8-20(17-19)21-9-4-5-12-26-21/h2-12,17H,13-16,18H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | SOMLJCQPVYINSZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|