C19H20N4OS — CID 155953760
(3-aminothieno[2,3-b]pyridin-2-yl)-(3-anilinopiperidin-1-yl)methanone (PubChem CID 155953760) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is (3-aminothieno[2,3-b]pyridin-2-yl)-(3-anilinopiperidin-1-yl)methanone.
| Compound Name | (3-aminothieno[2,3-b]pyridin-2-yl)-(3-anilinopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 155953760 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (3-aminothieno[2,3-b]pyridin-2-yl)-(3-anilinopiperidin-1-yl)methanone |
| SMILES | Nc1c(C(=O)N2CCCC(Nc3ccccc3)C2)sc2ncccc12 |
| InChI | InChI=1S/C19H20N4OS/c20-16-15-9-4-10-21-18(15)25-17(16)19(24)23-11-5-8-14(12-23)22-13-6-2-1-3-7-13/h1-4,6-7,9-10,14,22H,5,8,11-12,20H2 |
| InChIKey | NZVPRAJUWNEOKC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |