C19H31FN2O3 — CID 155957664
tert-butyl 4-[[1-(2-fluoroethyl)cyclopropanecarbonyl]amino]-4-prop-2-enylpiperidine-1-carboxylate (PubChem CID 155957664) has the molecular formula C19H31FN2O3 and a molecular weight of 354.47 g/mol. Its IUPAC name is tert-butyl 4-[[1-(2-fluoroethyl)cyclopropanecarbonyl]amino]-4-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(2-fluoroethyl)cyclopropanecarbonyl]amino]-4-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 155957664 |
| Molecular Formula | C19H31FN2O3 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl 4-[[1-(2-fluoroethyl)cyclopropanecarbonyl]amino]-4-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CCC1(NC(=O)C2(CCF)CC2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H31FN2O3/c1-5-6-19(21-15(23)18(7-8-18)9-12-20)10-13-22(14-11-19)16(24)25-17(2,3)4/h5H,1,6-14H2,2-4H3,(H,21,23) |
| InChIKey | VXRHFKLFNWAIAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|