C15H20F2N2O5S — CID 155960584
N-[4-(difluoromethoxy)phenyl]sulfonyl-2-(1-methoxypiperidin-4-yl)acetamide (PubChem CID 155960584) has the molecular formula C15H20F2N2O5S and a molecular weight of 378.40 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]sulfonyl-2-(1-methoxypiperidin-4-yl)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]sulfonyl-2-(1-methoxypiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 155960584 |
| Molecular Formula | C15H20F2N2O5S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]sulfonyl-2-(1-methoxypiperidin-4-yl)acetamide |
| SMILES | CON1CCC(CC(=O)NS(=O)(=O)c2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H20F2N2O5S/c1-23-19-8-6-11(7-9-19)10-14(20)18-25(21,22)13-4-2-12(3-5-13)24-15(16)17/h2-5,11,15H,6-10H2,1H3,(H,18,20) |
| InChIKey | NJUCDAHRFJPWSA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |