C18H22N6O — CID 155962208
1-methyl-2-[3-[4-(2H-tetrazol-5-yl)phenoxy]propyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 155962208) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 1-methyl-2-[3-[4-(2H-tetrazol-5-yl)phenoxy]propyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 1-methyl-2-[3-[4-(2H-tetrazol-5-yl)phenoxy]propyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 155962208 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 1-methyl-2-[3-[4-(2H-tetrazol-5-yl)phenoxy]propyl]-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CC1c2cccn2CCN1CCCOc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H22N6O/c1-14-17-4-2-9-24(17)12-11-23(14)10-3-13-25-16-7-5-15(6-8-16)18-19-21-22-20-18/h2,4-9,14H,3,10-13H2,1H3,(H,19,20,21,22) |
| InChIKey | YKQKKOQWZJMYCX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|