C14H15N7O3 — CID 162657899
2-[4-[4-(2H-tetrazol-5-yl)phenoxy]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 162657899) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[4-[4-(2H-tetrazol-5-yl)phenoxy]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-(2H-tetrazol-5-yl)phenoxy]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 162657899 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-[4-[4-(2H-tetrazol-5-yl)phenoxy]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(CCCCOc2ccc(-c3nn[nH]n3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N7O3/c22-12-9-15-21(14(23)16-12)7-1-2-8-24-11-5-3-10(4-6-11)13-17-19-20-18-13/h3-6,9H,1-2,7-8H2,(H,16,22,23)(H,17,18,19,20) |
| InChIKey | AWFAVLWXXSTLDL-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|