C16H12Cl3NO3 — CID 155964162
2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2,4-dichlorophenyl)acetic acid (PubChem CID 155964162) has the molecular formula C16H12Cl3NO3 and a molecular weight of 372.64 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2,4-dichlorophenyl)acetic acid.
| Compound Name | 2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2,4-dichlorophenyl)acetic acid |
|---|---|
| PubChem CID | 155964162 |
| Molecular Formula | C16H12Cl3NO3 |
| Molecular Weight | 372.64 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)acetyl]amino]-2-(2,4-dichlorophenyl)acetic acid |
| SMILES | O=C(Cc1cccc(Cl)c1)NC(C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3NO3/c17-10-3-1-2-9(6-10)7-14(21)20-15(16(22)23)12-5-4-11(18)8-13(12)19/h1-6,8,15H,7H2,(H,20,21)(H,22,23) |
| InChIKey | GSKDVLHLVGUEAC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |