C22H21N3O3S — CID 155964211
1-(2-methylpropyl)-N-quinolin-8-ylsulfonylindole-4-carboxamide (PubChem CID 155964211) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 1-(2-methylpropyl)-N-quinolin-8-ylsulfonylindole-4-carboxamide.
| Compound Name | 1-(2-methylpropyl)-N-quinolin-8-ylsulfonylindole-4-carboxamide |
|---|---|
| PubChem CID | 155964211 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-(2-methylpropyl)-N-quinolin-8-ylsulfonylindole-4-carboxamide |
| SMILES | CC(C)Cn1ccc2c(C(=O)NS(=O)(=O)c3cccc4cccnc34)cccc21 |
| InChI | InChI=1S/C22H21N3O3S/c1-15(2)14-25-13-11-17-18(8-4-9-19(17)25)22(26)24-29(27,28)20-10-3-6-16-7-5-12-23-21(16)20/h3-13,15H,14H2,1-2H3,(H,24,26) |
| InChIKey | BARHNAMYXDRQMG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |