C12H14N6O — CID 155965703
6-[(4-cyclopropyl-1H-pyrazol-5-yl)methylamino]pyrimidine-4-carboxamide (PubChem CID 155965703) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-[(4-cyclopropyl-1H-pyrazol-5-yl)methylamino]pyrimidine-4-carboxamide.
| Compound Name | 6-[(4-cyclopropyl-1H-pyrazol-5-yl)methylamino]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 155965703 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 6-[(4-cyclopropyl-1H-pyrazol-5-yl)methylamino]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1cc(NCc2[nH]ncc2C2CC2)ncn1 |
| InChI | InChI=1S/C12H14N6O/c13-12(19)9-3-11(16-6-15-9)14-5-10-8(4-17-18-10)7-1-2-7/h3-4,6-7H,1-2,5H2,(H2,13,19)(H,17,18)(H,14,15,16) |
| InChIKey | CHLMCEAOPMJNBX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |