C32H31N3O2 — CID 155968206
1-[1-[4-[(4-methylphenyl)methoxy]phenyl]propan-2-yl]-3-(2-phenyl-1H-indol-3-yl)urea (PubChem CID 155968206) has the molecular formula C32H31N3O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[1-[4-[(4-methylphenyl)methoxy]phenyl]propan-2-yl]-3-(2-phenyl-1H-indol-3-yl)urea.
| Compound Name | 1-[1-[4-[(4-methylphenyl)methoxy]phenyl]propan-2-yl]-3-(2-phenyl-1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 155968206 |
| Molecular Formula | C32H31N3O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 1-[1-[4-[(4-methylphenyl)methoxy]phenyl]propan-2-yl]-3-(2-phenyl-1H-indol-3-yl)urea |
| SMILES | Cc1ccc(COc2ccc(CC(C)NC(=O)Nc3c(-c4ccccc4)[nH]c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C32H31N3O2/c1-22-12-14-25(15-13-22)21-37-27-18-16-24(17-19-27)20-23(2)33-32(36)35-31-28-10-6-7-11-29(28)34-30(31)26-8-4-3-5-9-26/h3-19,23,34H,20-21H2,1-2H3,(H2,33,35,36) |
| InChIKey | FSFDMCZDSWNXDU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |