C24H28N2O7 — CID 155971696
2-[(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-phenylmorpholin-4-yl]-1-morpholin-4-ylethanone;formic acid (PubChem CID 155971696) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-phenylmorpholin-4-yl]-1-morpholin-4-ylethanone;formic acid.
| Compound Name | 2-[(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-phenylmorpholin-4-yl]-1-morpholin-4-ylethanone;formic acid |
|---|---|
| PubChem CID | 155971696 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-[(2S,6R)-2-(1,3-benzodioxol-5-yl)-6-phenylmorpholin-4-yl]-1-morpholin-4-ylethanone;formic acid |
| SMILES | O=C(CN1C[C@@H](c2ccccc2)O[C@@H](c2ccc3c(c2)OCO3)C1)N1CCOCC1.O=CO |
| InChI | InChI=1S/C23H26N2O5.CH2O2/c26-23(25-8-10-27-11-9-25)15-24-13-21(17-4-2-1-3-5-17)30-22(14-24)18-6-7-19-20(12-18)29-16-28-19;2-1-3/h1-7,12,21-22H,8-11,13-16H2;1H,(H,2,3)/t21-,22+;/m0./s1 |
| InChIKey | SLXMDZWUYUBIIQ-UMIAIAFLSA-N |
| XLogP | 2.09 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|