C23H26N4O5 — CID 155972303
(2S,6R)-2-(1,3-benzodioxol-5-yl)-4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-6-phenylmorpholine;formic acid (PubChem CID 155972303) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is (2S,6R)-2-(1,3-benzodioxol-5-yl)-4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-6-phenylmorpholine;formic acid.
| Compound Name | (2S,6R)-2-(1,3-benzodioxol-5-yl)-4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-6-phenylmorpholine;formic acid |
|---|---|
| PubChem CID | 155972303 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (2S,6R)-2-(1,3-benzodioxol-5-yl)-4-[(2-ethyl-1,2,4-triazol-3-yl)methyl]-6-phenylmorpholine;formic acid |
| SMILES | CCn1ncnc1CN1C[C@@H](c2ccccc2)O[C@@H](c2ccc3c(c2)OCO3)C1.O=CO |
| InChI | InChI=1S/C22H24N4O3.CH2O2/c1-2-26-22(23-14-24-26)13-25-11-20(16-6-4-3-5-7-16)29-21(12-25)17-8-9-18-19(10-17)28-15-27-18;2-1-3/h3-10,14,20-21H,2,11-13,15H2,1H3;1H,(H,2,3)/t20-,21+;/m0./s1 |
| InChIKey | GJODARABTITCLA-JUDYQFGCSA-N |
| XLogP | 3.04 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|