C15H14N4O4S2 — CID 155972549
N-(5-benzylsulfanyl-1,2,4-thiadiazol-3-yl)-5-methyl-1,2-oxazole-4-carboxamide;formic acid (PubChem CID 155972549) has the molecular formula C15H14N4O4S2 and a molecular weight of 378.44 g/mol. Its IUPAC name is N-(5-benzylsulfanyl-1,2,4-thiadiazol-3-yl)-5-methyl-1,2-oxazole-4-carboxamide;formic acid.
| Compound Name | N-(5-benzylsulfanyl-1,2,4-thiadiazol-3-yl)-5-methyl-1,2-oxazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 155972549 |
| Molecular Formula | C15H14N4O4S2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | N-(5-benzylsulfanyl-1,2,4-thiadiazol-3-yl)-5-methyl-1,2-oxazole-4-carboxamide;formic acid |
| SMILES | Cc1oncc1C(=O)Nc1nsc(SCc2ccccc2)n1.O=CO |
| InChI | InChI=1S/C14H12N4O2S2.CH2O2/c1-9-11(7-15-20-9)12(19)16-13-17-14(22-18-13)21-8-10-5-3-2-4-6-10;2-1-3/h2-7H,8H2,1H3,(H,16,18,19);1H,(H,2,3) |
| InChIKey | VNPSEWNVOCEZNU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|