C22H32N4O4 — CID 155972584
(4aR,8aS)-6-[(2-pyrazol-1-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;acetic acid (PubChem CID 155972584) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (4aR,8aS)-6-[(2-pyrazol-1-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;acetic acid.
| Compound Name | (4aR,8aS)-6-[(2-pyrazol-1-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;acetic acid |
|---|---|
| PubChem CID | 155972584 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (4aR,8aS)-6-[(2-pyrazol-1-ylphenyl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;acetic acid |
| SMILES | CC(=O)O.CC(=O)O.c1ccc(-n2cccn2)c(CN2CC[C@@H]3NCCC[C@@H]3C2)c1 |
| InChI | InChI=1S/C18H24N4.2C2H4O2/c1-2-7-18(22-11-4-10-20-22)16(5-1)14-21-12-8-17-15(13-21)6-3-9-19-17;2*1-2(3)4/h1-2,4-5,7,10-11,15,17,19H,3,6,8-9,12-14H2;2*1H3,(H,3,4)/t15-,17+;;/m1../s1 |
| InChIKey | SSNVLHWZXRSDQK-CKDKJTBNSA-N |
| XLogP | 2.63 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |