C8H12N4O2 — CID 155973267
methyl 2-pyrrolidin-3-yl-1,2,4-triazole-3-carboxylate (PubChem CID 155973267) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is methyl 2-pyrrolidin-3-yl-1,2,4-triazole-3-carboxylate.
| Compound Name | methyl 2-pyrrolidin-3-yl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 155973267 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | methyl 2-pyrrolidin-3-yl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncnn1C1CCNC1 |
| InChI | InChI=1S/C8H12N4O2/c1-14-8(13)7-10-5-11-12(7)6-2-3-9-4-6/h5-6,9H,2-4H2,1H3 |
| InChIKey | XGUVWBZPBTUBDX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |