About 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid
2-(1-oxo-1λ5-phospholan-1-yl)acetic acid (PubChem CID 155973567) has the molecular formula C6H11O3P
and a molecular weight of 162.12 g/mol. Its IUPAC name is 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid |
| PubChem CID | 155973567 |
| Molecular Formula | C6H11O3P |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid |
| SMILES | O=C(O)CP1(=O)CCCC1 |
| InChI | InChI=1S/C6H11O3P/c7-6(8)5-10(9)3-1-2-4-10/h1-5H2,(H,7,8) |
| InChIKey | PNDDEWGXCFJNQC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid?
The IUPAC name of 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid (CID 155973567) is 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid.
What is the SMILES notation for 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid?
The canonical SMILES for 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid is O=C(O)CP1(=O)CCCC1.
What is the InChIKey of 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid?
The InChIKey is PNDDEWGXCFJNQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O3P/c7-6(8)5-10(9)3-1-2-4-10/h1-5H2,(H,7,8).
What are the key properties of 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid?
2-(1-oxo-1λ5-phospholan-1-yl)acetic acid has a molecular weight of 162.12 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxo-1λ5-phospholan-1-yl)acetic acid is sourced from PubChem (CID 155973567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).