About 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine
6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 155974732) has the molecular formula C13H15BrN2O2S
and a molecular weight of 343.25 g/mol. Its IUPAC name is 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine |
| PubChem CID | 155974732 |
| Molecular Formula | C13H15BrN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CN(CC1COCCO1)c1nc2ccc(Br)cc2s1 |
| InChI | InChI=1S/C13H15BrN2O2S/c1-16(7-10-8-17-4-5-18-10)13-15-11-3-2-9(14)6-12(11)19-13/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | RFEBGOQGCILYMP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine?
The IUPAC name of 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine (CID 155974732) is 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine?
The canonical SMILES for 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine is CN(CC1COCCO1)c1nc2ccc(Br)cc2s1.
What is the InChIKey of 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine?
The InChIKey is RFEBGOQGCILYMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrN2O2S/c1-16(7-10-8-17-4-5-18-10)13-15-11-3-2-9(14)6-12(11)19-13/h2-3,6,10H,4-5,7-8H2,1H3.
What are the key properties of 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine?
6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine has a molecular weight of 343.25 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-(1,4-dioxan-2-ylmethyl)-N-methyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 155974732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).