C19H24N4O4S — CID 155974767
1-[1-(4-methoxy-1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione (PubChem CID 155974767) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[1-(4-methoxy-1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione.
| Compound Name | 1-[1-(4-methoxy-1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 155974767 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[1-(4-methoxy-1,3-benzothiazol-2-yl)piperidin-4-yl]-3-(2-methoxyethyl)imidazolidine-2,4-dione |
| SMILES | COCCN1C(=O)CN(C2CCN(c3nc4c(OC)cccc4s3)CC2)C1=O |
| InChI | InChI=1S/C19H24N4O4S/c1-26-11-10-22-16(24)12-23(19(22)25)13-6-8-21(9-7-13)18-20-17-14(27-2)4-3-5-15(17)28-18/h3-5,13H,6-12H2,1-2H3 |
| InChIKey | DJIIHJDIVJCYBX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|