C20H21N3O3 — CID 155977013
1-cyclopentyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione (PubChem CID 155977013) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-cyclopentyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-cyclopentyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 155977013 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-cyclopentyl-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1Cn1ccn(C2CCCC2)c(=O)c1=O |
| InChI | InChI=1S/C20H21N3O3/c1-14-17(21-18(26-14)15-7-3-2-4-8-15)13-22-11-12-23(20(25)19(22)24)16-9-5-6-10-16/h2-4,7-8,11-12,16H,5-6,9-10,13H2,1H3 |
| InChIKey | QYEHEGHUFOBCIS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|