C21H15F2N3O3 — CID 155977246
1-(3,4-difluorophenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione (PubChem CID 155977246) has the molecular formula C21H15F2N3O3 and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-(3,4-difluorophenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 155977246 |
| Molecular Formula | C21H15F2N3O3 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]pyrazine-2,3-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1Cn1ccn(-c2ccc(F)c(F)c2)c(=O)c1=O |
| InChI | InChI=1S/C21H15F2N3O3/c1-13-18(24-19(29-13)14-5-3-2-4-6-14)12-25-9-10-26(21(28)20(25)27)15-7-8-16(22)17(23)11-15/h2-11H,12H2,1H3 |
| InChIKey | ZKRNVTGFNCENQQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|