C14H12F2N2O2 — CID 163346803
1-(cyclopropylmethyl)-4-(3,4-difluorophenyl)pyrazine-2,3-dione (PubChem CID 163346803) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-(3,4-difluorophenyl)pyrazine-2,3-dione.
| Compound Name | 1-(cyclopropylmethyl)-4-(3,4-difluorophenyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163346803 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-(3,4-difluorophenyl)pyrazine-2,3-dione |
| SMILES | O=c1c(=O)n(-c2ccc(F)c(F)c2)ccn1CC1CC1 |
| InChI | InChI=1S/C14H12F2N2O2/c15-11-4-3-10(7-12(11)16)18-6-5-17(8-9-1-2-9)13(19)14(18)20/h3-7,9H,1-2,8H2 |
| InChIKey | UNAJATGGMMJGOZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|