C19H16F2N2O3 — CID 95917552
1-[(3,4-difluorophenyl)methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione (PubChem CID 95917552) has the molecular formula C19H16F2N2O3 and a molecular weight of 358.34 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 95917552 |
| Molecular Formula | C19H16F2N2O3 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione |
| SMILES | CCOc1ccc(-n2ccn(Cc3ccc(F)c(F)c3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C19H16F2N2O3/c1-2-26-15-6-4-14(5-7-15)23-10-9-22(18(24)19(23)25)12-13-3-8-16(20)17(21)11-13/h3-11H,2,12H2,1H3 |
| InChIKey | WFDPITZRBUFEAS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|