C22H20N4O4S — CID 95917565
1-(4-ethoxyphenyl)-4-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione (PubChem CID 95917565) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-4-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione.
| Compound Name | 1-(4-ethoxyphenyl)-4-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 95917565 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)-4-[[3-(4-methylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
| SMILES | CCOc1ccc(-n2ccn(Cc3nc(-c4ccc(SC)cc4)no3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C22H20N4O4S/c1-3-29-17-8-6-16(7-9-17)26-13-12-25(21(27)22(26)28)14-19-23-20(24-30-19)15-4-10-18(31-2)11-5-15/h4-13H,3,14H2,1-2H3 |
| InChIKey | UEMROAXZOPQMKT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|