C21H17ClN4O5 — CID 53157867
1-(4-chlorophenyl)-4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione (PubChem CID 53157867) has the molecular formula C21H17ClN4O5 and a molecular weight of 440.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione.
| Compound Name | 1-(4-chlorophenyl)-4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 53157867 |
| Molecular Formula | C21H17ClN4O5 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
| SMILES | COc1ccc(-c2noc(Cn3ccn(-c4ccc(Cl)cc4)c(=O)c3=O)n2)cc1OC |
| InChI | InChI=1S/C21H17ClN4O5/c1-29-16-8-3-13(11-17(16)30-2)19-23-18(31-24-19)12-25-9-10-26(21(28)20(25)27)15-6-4-14(22)5-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | ZPXVBFGIIINZMH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|