C20H15ClN4O4 — CID 53157863
1-(4-chlorophenyl)-4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione (PubChem CID 53157863) has the molecular formula C20H15ClN4O4 and a molecular weight of 410.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione.
| Compound Name | 1-(4-chlorophenyl)-4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 53157863 |
| Molecular Formula | C20H15ClN4O4 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
| SMILES | COc1ccc(-c2noc(Cn3ccn(-c4ccc(Cl)cc4)c(=O)c3=O)n2)cc1 |
| InChI | InChI=1S/C20H15ClN4O4/c1-28-16-8-2-13(3-9-16)18-22-17(29-23-18)12-24-10-11-25(20(27)19(24)26)15-6-4-14(21)5-7-15/h2-11H,12H2,1H3 |
| InChIKey | SZKAIOPIDKDQTK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|