C25H26N4O4 — CID 95917568
1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione (PubChem CID 95917568) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione.
| Compound Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 95917568 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(4-ethoxyphenyl)pyrazine-2,3-dione |
| SMILES | CCOc1ccc(-n2ccn(Cc3nc(-c4ccc(C(C)(C)C)cc4)no3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-5-32-20-12-10-19(11-13-20)29-15-14-28(23(30)24(29)31)16-21-26-22(27-33-21)17-6-8-18(9-7-17)25(2,3)4/h6-15H,5,16H2,1-4H3 |
| InChIKey | AQNQVECOPDBHAY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|