C20H15ClN4O3 — CID 53157872
1-(3-chlorophenyl)-4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione (PubChem CID 53157872) has the molecular formula C20H15ClN4O3 and a molecular weight of 394.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione.
| Compound Name | 1-(3-chlorophenyl)-4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 53157872 |
| Molecular Formula | C20H15ClN4O3 |
| Molecular Weight | 394.82 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]pyrazine-2,3-dione |
| SMILES | Cc1ccc(-c2noc(Cn3ccn(-c4cccc(Cl)c4)c(=O)c3=O)n2)cc1 |
| InChI | InChI=1S/C20H15ClN4O3/c1-13-5-7-14(8-6-13)18-22-17(28-23-18)12-24-9-10-25(20(27)19(24)26)16-4-2-3-15(21)11-16/h2-11H,12H2,1H3 |
| InChIKey | HMFWNRAIKWHFIY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|