C23H22N4O5 — CID 53157884
1-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione (PubChem CID 53157884) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is 1-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione.
| Compound Name | 1-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 53157884 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-(3,5-dimethylphenyl)pyrazine-2,3-dione |
| SMILES | COc1cccc(-c2noc(Cn3ccn(-c4cc(C)cc(C)c4)c(=O)c3=O)n2)c1OC |
| InChI | InChI=1S/C23H22N4O5/c1-14-10-15(2)12-16(11-14)27-9-8-26(22(28)23(27)29)13-19-24-21(25-32-19)17-6-5-7-18(30-3)20(17)31-4/h5-12H,13H2,1-4H3 |
| InChIKey | KNJLXBWHMVIUAQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|