C17H18N2O4 — CID 163346943
1-(1,3-benzodioxol-5-yl)-4-(cyclopentylmethyl)pyrazine-2,3-dione (PubChem CID 163346943) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-(cyclopentylmethyl)pyrazine-2,3-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-(cyclopentylmethyl)pyrazine-2,3-dione |
|---|---|
| PubChem CID | 163346943 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-(cyclopentylmethyl)pyrazine-2,3-dione |
| SMILES | O=c1c(=O)n(-c2ccc3c(c2)OCO3)ccn1CC1CCCC1 |
| InChI | InChI=1S/C17H18N2O4/c20-16-17(21)19(8-7-18(16)10-12-3-1-2-4-12)13-5-6-14-15(9-13)23-11-22-14/h5-9,12H,1-4,10-11H2 |
| InChIKey | FLTBSBNNYGOZBX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|