C15H14N2O4 — CID 163346970
1-(1,3-benzodioxol-5-yl)-4-but-3-enylpyrazine-2,3-dione (PubChem CID 163346970) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-but-3-enylpyrazine-2,3-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-but-3-enylpyrazine-2,3-dione |
|---|---|
| PubChem CID | 163346970 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-but-3-enylpyrazine-2,3-dione |
| SMILES | C=CCCn1ccn(-c2ccc3c(c2)OCO3)c(=O)c1=O |
| InChI | InChI=1S/C15H14N2O4/c1-2-3-6-16-7-8-17(15(19)14(16)18)11-4-5-12-13(9-11)21-10-20-12/h2,4-5,7-9H,1,3,6,10H2 |
| InChIKey | QSHCKJFSTYOIAH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|