C13H9NO5 — CID 82121117
1-(1,3-benzodioxol-5-yl)-2-oxopyridine-3-carboxylic acid (PubChem CID 82121117) has the molecular formula C13H9NO5 and a molecular weight of 259.22 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82121117 |
| Molecular Formula | C13H9NO5 |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-oxopyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccn(-c2ccc3c(c2)OCO3)c1=O |
| InChI | InChI=1S/C13H9NO5/c15-12-9(13(16)17)2-1-5-14(12)8-3-4-10-11(6-8)19-7-18-10/h1-6H,7H2,(H,16,17) |
| InChIKey | PHEMACGQCVULOK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |