2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid

C13H12N2O4 — CID 82301415

IUPAC2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid
SMILESCc1nc(CC(=O)O)cn1-c1ccc2c(c1)OCO2
InChIInChI=1S/C13H12N2O4/c1-8-14-9(4-13(16)17)6-15(8)10-2-3-11-12(5-10)19-7-18-11/h2-3,5-6H,4,7H2,1H3,(H,16,17)
InChIKeyKZSVFFRNHIKXCS-UHFFFAOYSA-N
MW260.25 g/mol
LogP1.54
Rot. Bonds3

About 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid

2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid (PubChem CID 82301415) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid
PubChem CID82301415
Molecular FormulaC13H12N2O4
Molecular Weight260.25 g/mol
Exact Mass260.08
IUPAC Name2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid
SMILESCc1nc(CC(=O)O)cn1-c1ccc2c(c1)OCO2
InChIInChI=1S/C13H12N2O4/c1-8-14-9(4-13(16)17)6-15(8)10-2-3-11-12(5-10)19-7-18-11/h2-3,5-6H,4,7H2,1H3,(H,16,17)
InChIKeyKZSVFFRNHIKXCS-UHFFFAOYSA-N
XLogP1.54
TPSA73.58 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.25
LogP ≤ 51.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid?
The IUPAC name of 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid (CID 82301415) is 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid?
The canonical SMILES for 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid is Cc1nc(CC(=O)O)cn1-c1ccc2c(c1)OCO2.
What is the InChIKey of 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid?
The InChIKey is KZSVFFRNHIKXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4/c1-8-14-9(4-13(16)17)6-15(8)10-2-3-11-12(5-10)19-7-18-11/h2-3,5-6H,4,7H2,1H3,(H,16,17).
What are the key properties of 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid?
2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid has a molecular weight of 260.25 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,3-benzodioxol-5-yl)-2-methylimidazol-4-yl]acetic acid is sourced from PubChem (CID 82301415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).