C20H24N2O3S — CID 155977371
2-(2,5-dimethylphenyl)-1,1-dioxo-4-pentyl-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 155977371) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1,1-dioxo-4-pentyl-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 2-(2,5-dimethylphenyl)-1,1-dioxo-4-pentyl-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 155977371 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1,1-dioxo-4-pentyl-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | CCCCCN1C(=O)N(c2cc(C)ccc2C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-5-8-13-21-17-9-6-7-10-19(17)26(24,25)22(20(21)23)18-14-15(2)11-12-16(18)3/h6-7,9-12,14H,4-5,8,13H2,1-3H3 |
| InChIKey | ZLGUGPJNYFAHHN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|