C21H28N2O2S — CID 130287244
N,3,6-trimethyl-5,5-dioxo-N-pentyl-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 130287244) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is N,3,6-trimethyl-5,5-dioxo-N-pentyl-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | N,3,6-trimethyl-5,5-dioxo-N-pentyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 130287244 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N,3,6-trimethyl-5,5-dioxo-N-pentyl-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | CCCCCN(C)C1c2ccccc2N(C)S(=O)(=O)c2cc(C)ccc21 |
| InChI | InChI=1S/C21H28N2O2S/c1-5-6-9-14-22(3)21-17-10-7-8-11-19(17)23(4)26(24,25)20-15-16(2)12-13-18(20)21/h7-8,10-13,15,21H,5-6,9,14H2,1-4H3 |
| InChIKey | ZSAKJNOOGQTGJR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|